C20H30F2O4 — CID 138525838
7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid (PubChem CID 138525838) has the molecular formula C20H30F2O4 and a molecular weight of 372.45 g/mol. Its IUPAC name is 7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid.
| Compound Name | 7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 138525838 |
| Molecular Formula | C20H30F2O4 |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 7-[(1R,2S)-2-(4,4-difluoro-3-oxooctyl)-5-oxocyclopent-3-en-1-yl]heptanoic acid |
| SMILES | CCCCC(F)(F)C(=O)CC[C@H]1C=CC(=O)[C@@H]1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H30F2O4/c1-2-3-14-20(21,22)18(24)13-11-15-10-12-17(23)16(15)8-6-4-5-7-9-19(25)26/h10,12,15-16H,2-9,11,13-14H2,1H3,(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | CNRMSAXGFGQPGP-HZPDHXFCSA-N |
| XLogP | 4.96 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|