C22H36F2O5 — CID 67635662
(Z)-9-[(2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-3,5-dihydroxycyclopentyl]non-7-enoic acid (PubChem CID 67635662) has the molecular formula C22H36F2O5 and a molecular weight of 418.52 g/mol. Its IUPAC name is (Z)-9-[(2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-3,5-dihydroxycyclopentyl]non-7-enoic acid.
| Compound Name | (Z)-9-[(2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-3,5-dihydroxycyclopentyl]non-7-enoic acid |
|---|---|
| PubChem CID | 67635662 |
| Molecular Formula | C22H36F2O5 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (Z)-9-[(2R,3R,5S)-2-(4,4-difluoro-3-oxooctyl)-3,5-dihydroxycyclopentyl]non-7-enoic acid |
| SMILES | CCCCC(F)(F)C(=O)CC[C@@H]1C(C/C=C\CCCCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H36F2O5/c1-2-3-14-22(23,24)20(27)13-12-17-16(18(25)15-19(17)26)10-8-6-4-5-7-9-11-21(28)29/h6,8,16-19,25-26H,2-5,7,9-15H2,1H3,(H,28,29)/b8-6-/t16?,17-,18+,19-/m1/s1 |
| InChIKey | LZUYAQRJACBBHE-AHLHYYNWSA-N |
| XLogP | 4.50 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|