C20H32F2O4 — CID 101367758
(Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 101367758) has the molecular formula C20H32F2O4 and a molecular weight of 374.47 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 101367758 |
| Molecular Formula | C20H32F2O4 |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluorooct-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCCC(F)(F)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H32F2O4/c1-2-3-8-12-20(21,22)13-11-16-15(17(23)14-18(16)24)9-6-4-5-7-10-19(25)26/h4,6,11,13,15-18,23-24H,2-3,5,7-10,12,14H2,1H3,(H,25,26)/b6-4-,13-11+/t15-,16-,17+,18-/m1/s1 |
| InChIKey | YVAHUGYOTQBBAA-POLQPNDMSA-N |
| XLogP | 4.32 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|