C18H28F2O3 — CID 162283914
(Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoropent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one (PubChem CID 162283914) has the molecular formula C18H28F2O3 and a molecular weight of 330.42 g/mol. Its IUPAC name is (Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoropent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one.
| Compound Name | (Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoropent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one |
|---|---|
| PubChem CID | 162283914 |
| Molecular Formula | C18H28F2O3 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoropent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one |
| SMILES | CCC(F)(F)C=C[C@@H]1[C@@H](C/C=C\CCCC(C)=O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C18H28F2O3/c1-3-18(19,20)11-10-15-14(16(22)12-17(15)23)9-7-5-4-6-8-13(2)21/h5,7,10-11,14-17,22-23H,3-4,6,8-9,12H2,1-2H3/b7-5-,11-10?/t14-,15-,16+,17-/m1/s1 |
| InChIKey | SVFKWHWXOJRVIL-QJNQIZEKSA-N |
| XLogP | 3.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|