C23H41NO4 — CID 95065785
(Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]-N-ethylhept-5-enamide (PubChem CID 95065785) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 95065785 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5R)-3,5-dihydroxy-2-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
| SMILES | CCCCC[C@](C)(O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)NCC)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H41NO4/c1-4-6-11-15-23(3,28)16-14-19-18(20(25)17-21(19)26)12-9-7-8-10-13-22(27)24-5-2/h7,9,14,16,18-21,25-26,28H,4-6,8,10-13,15,17H2,1-3H3,(H,24,27)/b9-7-,16-14+/t18-,19-,20-,21-,23+/m1/s1 |
| InChIKey | IYZNFEULIFISHM-FCBLQLHMSA-N |
| XLogP | 3.48 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|