C15H27NO3 — CID 139246889
(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]-N-ethylhept-5-enamide (PubChem CID 139246889) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 139246889 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-methylcyclopentyl]-N-ethylhept-5-enamide |
| SMILES | CCNC(=O)CCC/C=C\C[C@@H]1[C@@H](C)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C15H27NO3/c1-3-16-15(19)9-7-5-4-6-8-12-11(2)13(17)10-14(12)18/h4,6,11-14,17-18H,3,5,7-10H2,1-2H3,(H,16,19)/b6-4-/t11-,12-,13-,14+/m1/s1 |
| InChIKey | YDQOQVPKOVKYDE-JZCWBKOCSA-N |
| XLogP | 1.62 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|