C25H35F2NO3 — CID 123551425
7-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenylpent-1-enyl)-3,5-dihydroxycyclopentyl]-N-ethylhept-5-enamide (PubChem CID 123551425) has the molecular formula C25H35F2NO3 and a molecular weight of 435.56 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenylpent-1-enyl)-3,5-dihydroxycyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | 7-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenylpent-1-enyl)-3,5-dihydroxycyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 123551425 |
| Molecular Formula | C25H35F2NO3 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenylpent-1-enyl)-3,5-dihydroxycyclopentyl]-N-ethylhept-5-enamide |
| SMILES | CCNC(=O)CCCC=CC[C@@H]1[C@@H](C=CC(F)(F)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H35F2NO3/c1-2-28-24(31)13-9-4-3-8-12-20-21(23(30)18-22(20)29)15-17-25(26,27)16-14-19-10-6-5-7-11-19/h3,5-8,10-11,15,17,20-23,29-30H,2,4,9,12-14,16,18H2,1H3,(H,28,31)/t20-,21-,22+,23-/m1/s1 |
| InChIKey | VGXZJUHBFKABLQ-BXXSPATCSA-N |
| XLogP | 4.42 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|