C24H32F2O4 — CID 162282565
(Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenoxypent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one (PubChem CID 162282565) has the molecular formula C24H32F2O4 and a molecular weight of 422.51 g/mol. Its IUPAC name is (Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenoxypent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one.
| Compound Name | (Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenoxypent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one |
|---|---|
| PubChem CID | 162282565 |
| Molecular Formula | C24H32F2O4 |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | (Z)-8-[(1R,2R,3R,5S)-2-(3,3-difluoro-5-phenoxypent-1-enyl)-3,5-dihydroxycyclopentyl]oct-6-en-2-one |
| SMILES | CC(=O)CCC/C=C\C[C@@H]1[C@@H](C=CC(F)(F)CCOc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C24H32F2O4/c1-18(27)9-5-2-3-8-12-20-21(23(29)17-22(20)28)13-14-24(25,26)15-16-30-19-10-6-4-7-11-19/h3-4,6-8,10-11,13-14,20-23,28-29H,2,5,9,12,15-17H2,1H3/b8-3-,14-13?/t20-,21-,22+,23-/m1/s1 |
| InChIKey | QEIZVXMGVLUJEO-OEBXMZMASA-N |
| XLogP | 4.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|