C29H40F2N2O10 — CID 122657737
[(2S)-2-[[2-(2-nitrooxyethoxy)acetyl]amino]propyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 122657737) has the molecular formula C29H40F2N2O10 and a molecular weight of 614.64 g/mol. Its IUPAC name is [(2S)-2-[[2-(2-nitrooxyethoxy)acetyl]amino]propyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | [(2S)-2-[[2-(2-nitrooxyethoxy)acetyl]amino]propyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 122657737 |
| Molecular Formula | C29H40F2N2O10 |
| Molecular Weight | 614.64 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | [(2S)-2-[[2-(2-nitrooxyethoxy)acetyl]amino]propyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | C[C@@H](COC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(F)(F)COc2ccccc2)[C@H](O)C[C@@H]1O)NC(=O)COCCO[N+](=O)[O-] |
| InChI | InChI=1S/C29H40F2N2O10/c1-21(32-27(36)19-40-15-16-43-33(38)39)18-41-28(37)12-8-3-2-7-11-23-24(26(35)17-25(23)34)13-14-29(30,31)20-42-22-9-5-4-6-10-22/h2,4-7,9-10,13-14,21,23-26,34-35H,3,8,11-12,15-20H2,1H3,(H,32,36)/b7-2-,14-13+/t21-,23+,24+,25-,26+/m0/s1 |
| InChIKey | QNEJPRRKEJRUKU-NGFUWIJVSA-N |
| XLogP | 3.00 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|