C26H36ClNO10 — CID 58963226
2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 58963226) has the molecular formula C26H36ClNO10 and a molecular weight of 558.02 g/mol. Its IUPAC name is 2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | 2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58963226 |
| Molecular Formula | C26H36ClNO10 |
| Molecular Weight | 558.02 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 2-(2-nitrooxyethoxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)OCCOCCO[N+](=O)[O-] |
| InChI | InChI=1S/C26H36ClNO10/c27-19-6-5-7-21(16-19)37-18-20(29)10-11-23-22(24(30)17-25(23)31)8-3-1-2-4-9-26(32)36-14-12-35-13-15-38-28(33)34/h1,3,5-7,10-11,16,20,22-25,29-31H,2,4,8-9,12-15,17-18H2/b3-1-,11-10+/t20-,22-,23-,24+,25-/m1/s1 |
| InChIKey | LVLYUEJOGXBFMQ-IHCNRLCCSA-N |
| XLogP | 2.88 |
| TPSA | 157.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.02 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|