C35H44ClNO11 — CID 58963235
[4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 58963235) has the molecular formula C35H44ClNO11 and a molecular weight of 690.19 g/mol. Its IUPAC name is [4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | [4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58963235 |
| Molecular Formula | C35H44ClNO11 |
| Molecular Weight | 690.19 g/mol |
| Exact Mass | 689.26 |
| IUPAC Name | [4-[2-(5-nitrooxypentanoyloxy)ethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | O=C(CCCCO[N+](=O)[O-])OCCc1ccc(OC(=O)CCC/C=C\C[C@@H]2[C@@H](/C=C/[C@@H](O)COc3cccc(Cl)c3)[C@H](O)C[C@@H]2O)cc1 |
| InChI | InChI=1S/C35H44ClNO11/c36-26-8-7-9-29(22-26)46-24-27(38)15-18-31-30(32(39)23-33(31)40)10-3-1-2-4-12-35(42)48-28-16-13-25(14-17-28)19-21-45-34(41)11-5-6-20-47-37(43)44/h1,3,7-9,13-18,22,27,30-33,38-40H,2,4-6,10-12,19-21,23-24H2/b3-1-,18-15+/t27-,30-,31-,32+,33-/m1/s1 |
| InChIKey | GUMOPHCBESZECO-HXVYRMKXSA-N |
| XLogP | 5.18 |
| TPSA | 174.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.19 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|