C27H37ClN2O10 — CID 90719838
3-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]acetate (PubChem CID 90719838) has the molecular formula C27H37ClN2O10 and a molecular weight of 585.05 g/mol. Its IUPAC name is 3-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]acetate.
| Compound Name | 3-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]acetate |
|---|---|
| PubChem CID | 90719838 |
| Molecular Formula | C27H37ClN2O10 |
| Molecular Weight | 585.05 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 3-nitrooxypropyl 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]acetate |
| SMILES | O=C(CCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)NCC(=O)OCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C27H37ClN2O10/c28-19-7-5-8-21(15-19)39-18-20(31)11-12-23-22(24(32)16-25(23)33)9-3-1-2-4-10-26(34)29-17-27(35)38-13-6-14-40-30(36)37/h1,3,5,7-8,11-12,15,20,22-25,31-33H,2,4,6,9-10,13-14,16-18H2,(H,29,34)/t20-,22-,23-,24+,25-/m1/s1 |
| InChIKey | QZBNPNSCQLYMHS-OYHORMKUSA-N |
| XLogP | 2.37 |
| TPSA | 177.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.05 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|