C29H40F3NO10 — CID 90842261
2-(4-nitrooxybutoxy)ethyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 90842261) has the molecular formula C29H40F3NO10 and a molecular weight of 619.63 g/mol. Its IUPAC name is 2-(4-nitrooxybutoxy)ethyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 2-(4-nitrooxybutoxy)ethyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90842261 |
| Molecular Formula | C29H40F3NO10 |
| Molecular Weight | 619.63 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | 2-(4-nitrooxybutoxy)ethyl 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)OCCOCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C29H40F3NO10/c30-29(31,32)21-8-7-9-23(18-21)42-20-22(34)12-13-25-24(26(35)19-27(25)36)10-3-1-2-4-11-28(37)41-17-16-40-14-5-6-15-43-33(38)39/h1,3,7-9,12-13,18,22,24-27,34-36H,2,4-6,10-11,14-17,19-20H2/t22-,24-,25-,26+,27-/m1/s1 |
| InChIKey | YUTNBOCZKXNVSQ-HHKAQOQUSA-N |
| XLogP | 4.02 |
| TPSA | 157.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|