C26H36F3NO9 — CID 70669019
3-(dihydroxyamino)oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 70669019) has the molecular formula C26H36F3NO9 and a molecular weight of 563.57 g/mol. Its IUPAC name is 3-(dihydroxyamino)oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 3-(dihydroxyamino)oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669019 |
| Molecular Formula | C26H36F3NO9 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 3-(dihydroxyamino)oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)OCCCON(O)O |
| InChI | InChI=1S/C26H36F3NO9/c27-26(28,29)18-7-5-8-20(15-18)38-17-19(31)11-12-22-21(23(32)16-24(22)33)9-3-1-2-4-10-25(34)37-13-6-14-39-30(35)36/h1,3,5,7-8,11-12,15,19,21-24,31-33,35-36H,2,4,6,9-10,13-14,16-17H2/b3-1-,12-11+/t19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | HPHYIGPCYTVONG-FTWMQKTESA-N |
| XLogP | 3.42 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|