C29H42F3NO9 — CID 70669015
6-(dihydroxyamino)oxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 70669015) has the molecular formula C29H42F3NO9 and a molecular weight of 605.65 g/mol. Its IUPAC name is 6-(dihydroxyamino)oxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 6-(dihydroxyamino)oxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669015 |
| Molecular Formula | C29H42F3NO9 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 605.28 |
| IUPAC Name | 6-(dihydroxyamino)oxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)OCCCCCCON(O)O |
| InChI | InChI=1S/C29H42F3NO9/c30-29(31,32)21-10-9-11-23(18-21)41-20-22(34)14-15-25-24(26(35)19-27(25)36)12-5-1-2-6-13-28(37)40-16-7-3-4-8-17-42-33(38)39/h1,5,9-11,14-15,18,22,24-27,34-36,38-39H,2-4,6-8,12-13,16-17,19-20H2/b5-1-,15-14+/t22-,24-,25-,26+,27-/m1/s1 |
| InChIKey | OMSVBQCOZTXRRX-DVUHDDEVSA-N |
| XLogP | 4.59 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|