C26H37F3N2O8 — CID 89069020
(Z)-N-[2-(dihydroxyamino)oxyethyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]-N-methylhept-5-enamide (PubChem CID 89069020) has the molecular formula C26H37F3N2O8 and a molecular weight of 562.58 g/mol. Its IUPAC name is (Z)-N-[2-(dihydroxyamino)oxyethyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]-N-methylhept-5-enamide.
| Compound Name | (Z)-N-[2-(dihydroxyamino)oxyethyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]-N-methylhept-5-enamide |
|---|---|
| PubChem CID | 89069020 |
| Molecular Formula | C26H37F3N2O8 |
| Molecular Weight | 562.58 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | (Z)-N-[2-(dihydroxyamino)oxyethyl]-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]-N-methylhept-5-enamide |
| SMILES | CN(CCON(O)O)C(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H37F3N2O8/c1-30(13-14-39-31(36)37)25(35)10-5-3-2-4-9-21-22(24(34)16-23(21)33)12-11-19(32)17-38-20-8-6-7-18(15-20)26(27,28)29/h2,4,6-8,11-12,15,19,21-24,32-34,36-37H,3,5,9-10,13-14,16-17H2,1H3/b4-2-,12-11+/t19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | HXBBWJQSVZPGBB-VNMHANGOSA-N |
| XLogP | 2.95 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.58 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|