C27H37F3N2O10 — CID 89068884
2-(dihydroxyamino)oxyethyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate (PubChem CID 89068884) has the molecular formula C27H37F3N2O10 and a molecular weight of 606.59 g/mol. Its IUPAC name is 2-(dihydroxyamino)oxyethyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate.
| Compound Name | 2-(dihydroxyamino)oxyethyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate |
|---|---|
| PubChem CID | 89068884 |
| Molecular Formula | C27H37F3N2O10 |
| Molecular Weight | 606.59 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | 2-(dihydroxyamino)oxyethyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)NCC(=O)OCCON(O)O |
| InChI | InChI=1S/C27H37F3N2O10/c28-27(29,30)18-6-5-7-20(14-18)41-17-19(33)10-11-22-21(23(34)15-24(22)35)8-3-1-2-4-9-25(36)31-16-26(37)40-12-13-42-32(38)39/h1,3,5-7,10-11,14,19,21-24,33-35,38-39H,2,4,8-9,12-13,15-17H2,(H,31,36)/b3-1-,11-10+/t19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | MNMKKCMXYUFOFE-CTZICMAHSA-N |
| XLogP | 2.15 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.59 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|