C28H39F3N2O10 — CID 89068882
2-(dihydroxyamino)oxypropyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate (PubChem CID 89068882) has the molecular formula C28H39F3N2O10 and a molecular weight of 620.62 g/mol. Its IUPAC name is 2-(dihydroxyamino)oxypropyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate.
| Compound Name | 2-(dihydroxyamino)oxypropyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate |
|---|---|
| PubChem CID | 89068882 |
| Molecular Formula | C28H39F3N2O10 |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.26 |
| IUPAC Name | 2-(dihydroxyamino)oxypropyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoyl]amino]acetate |
| SMILES | CC(COC(=O)CNC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)ON(O)O |
| InChI | InChI=1S/C28H39F3N2O10/c1-18(43-33(39)40)16-42-27(38)15-32-26(37)10-5-3-2-4-9-22-23(25(36)14-24(22)35)12-11-20(34)17-41-21-8-6-7-19(13-21)28(29,30)31/h2,4,6-8,11-13,18,20,22-25,34-36,39-40H,3,5,9-10,14-17H2,1H3,(H,32,37)/b4-2-,12-11+/t18?,20-,22-,23-,24+,25-/m1/s1 |
| InChIKey | AEBVQQREKGSOOW-AMPONVJJSA-N |
| XLogP | 2.54 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|