C27H38F3NO9S — CID 70669053
2-[2-(dihydroxyamino)oxyethylsulfanyl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 70669053) has the molecular formula C27H38F3NO9S and a molecular weight of 609.66 g/mol. Its IUPAC name is 2-[2-(dihydroxyamino)oxyethylsulfanyl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 2-[2-(dihydroxyamino)oxyethylsulfanyl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669053 |
| Molecular Formula | C27H38F3NO9S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | 2-[2-(dihydroxyamino)oxyethylsulfanyl]ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)OCCSCCON(O)O |
| InChI | InChI=1S/C27H38F3NO9S/c28-27(29,30)19-6-5-7-21(16-19)39-18-20(32)10-11-23-22(24(33)17-25(23)34)8-3-1-2-4-9-26(35)38-12-14-41-15-13-40-31(36)37/h1,3,5-7,10-11,16,20,22-25,32-34,36-37H,2,4,8-9,12-15,17-18H2/b3-1-,11-10+/t20-,22-,23-,24+,25-/m1/s1 |
| InChIKey | JYMYHJCLDIHCRZ-IHCNRLCCSA-N |
| XLogP | 3.76 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|