C25H31F3O7 — CID 175855466
2-oxoethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 175855466) has the molecular formula C25H31F3O7 and a molecular weight of 500.51 g/mol. Its IUPAC name is 2-oxoethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 2-oxoethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 175855466 |
| Molecular Formula | C25H31F3O7 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | 2-oxoethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=CCOC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H31F3O7/c26-25(27,28)17-6-5-7-19(14-17)35-16-18(30)10-11-21-20(22(31)15-23(21)32)8-3-1-2-4-9-24(33)34-13-12-29/h1,3,5-7,10-12,14,18,20-23,30-32H,2,4,8-9,13,15-16H2/b3-1-,11-10+/t18-,20-,21-,22+,23-/m1/s1 |
| InChIKey | ZEJRBUQFSNJATF-RQAKXNOKSA-N |
| XLogP | 3.22 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|