C25H32F3NO9 — CID 11432777
2-nitrooxyethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 11432777) has the molecular formula C25H32F3NO9 and a molecular weight of 547.52 g/mol. Its IUPAC name is 2-nitrooxyethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 2-nitrooxyethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11432777 |
| Molecular Formula | C25H32F3NO9 |
| Molecular Weight | 547.52 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 2-nitrooxyethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)OCCO[N+](=O)[O-] |
| InChI | InChI=1S/C25H32F3NO9/c26-25(27,28)17-6-5-7-19(14-17)37-16-18(30)10-11-21-20(22(31)15-23(21)32)8-3-1-2-4-9-24(33)36-12-13-38-29(34)35/h1,3,5-7,10-11,14,18,20-23,30-32H,2,4,8-9,12-13,15-16H2/b3-1-,11-10+/t18-,20-,21-,22+,23-/m1/s1 |
| InChIKey | LBXUKHKGYAGKNX-RQAKXNOKSA-N |
| XLogP | 3.23 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|