C30H34F3NO9 — CID 58963211
[3-(nitrooxymethyl)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 58963211) has the molecular formula C30H34F3NO9 and a molecular weight of 609.59 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | [3-(nitrooxymethyl)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 58963211 |
| Molecular Formula | C30H34F3NO9 |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 609.22 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-hydroxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O)Oc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H34F3NO9/c31-30(32,33)21-8-6-9-23(16-21)41-19-22(35)13-14-26-25(27(36)17-28(26)37)11-3-1-2-4-12-29(38)43-24-10-5-7-20(15-24)18-42-34(39)40/h1,3,5-10,13-16,22,25-28,35-37H,2,4,11-12,17-19H2/b3-1-,14-13+/t22-,25-,26-,27+,28-/m1/s1 |
| InChIKey | JDVFTPBUVRFYST-RRSXTGKJSA-N |
| XLogP | 4.79 |
| TPSA | 148.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|