C32H49ClN4O8 — CID 91563240
3-[4-[3-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl]piperazin-1-yl]propyl nitrate (PubChem CID 91563240) has the molecular formula C32H49ClN4O8 and a molecular weight of 653.22 g/mol. Its IUPAC name is 3-[4-[3-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl]piperazin-1-yl]propyl nitrate.
| Compound Name | 3-[4-[3-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl]piperazin-1-yl]propyl nitrate |
|---|---|
| PubChem CID | 91563240 |
| Molecular Formula | C32H49ClN4O8 |
| Molecular Weight | 653.22 g/mol |
| Exact Mass | 652.32 |
| IUPAC Name | 3-[4-[3-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl]piperazin-1-yl]propyl nitrate |
| SMILES | O=C(CCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)NCCCN1CCN(CCCO[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C32H49ClN4O8/c33-25-8-5-9-27(22-25)44-24-26(38)12-13-29-28(30(39)23-31(29)40)10-3-1-2-4-11-32(41)34-14-6-15-35-17-19-36(20-18-35)16-7-21-45-37(42)43/h1,3,5,8-9,12-13,22,26,28-31,38-40H,2,4,6-7,10-11,14-21,23-24H2,(H,34,41)/t26-,28-,29-,30+,31-/m1/s1 |
| InChIKey | CVJAXBNAOQZVDR-RERJCABYSA-N |
| XLogP | 2.83 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|