C32H39ClN2O10 — CID 15942539
[2-(nitrooxymethyl)phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate (PubChem CID 15942539) has the molecular formula C32H39ClN2O10 and a molecular weight of 647.12 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate.
| Compound Name | [2-(nitrooxymethyl)phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 15942539 |
| Molecular Formula | C32H39ClN2O10 |
| Molecular Weight | 647.12 g/mol |
| Exact Mass | 646.23 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl] 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate |
| SMILES | CC(NC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)C(=O)Oc1ccccc1CO[N+](=O)[O-] |
| InChI | InChI=1S/C32H39ClN2O10/c1-21(32(40)45-30-13-7-6-9-22(30)19-44-35(41)42)34-31(39)14-5-3-2-4-12-26-27(29(38)18-28(26)37)16-15-24(36)20-43-25-11-8-10-23(33)17-25/h2,4,6-11,13,15-17,21,24,26-29,36-38H,3,5,12,14,18-20H2,1H3,(H,34,39)/b4-2-,16-15+/t21?,24-,26-,27-,28+,29-/m1/s1 |
| InChIKey | IGBIFIDJVLXQBT-MEKQPNGZSA-N |
| XLogP | 3.93 |
| TPSA | 177.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.12 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|