C29H43ClN2O10 — CID 89068876
4-(dihydroxyamino)oxybutyl 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate (PubChem CID 89068876) has the molecular formula C29H43ClN2O10 and a molecular weight of 615.12 g/mol. Its IUPAC name is 4-(dihydroxyamino)oxybutyl 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate.
| Compound Name | 4-(dihydroxyamino)oxybutyl 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 89068876 |
| Molecular Formula | C29H43ClN2O10 |
| Molecular Weight | 615.12 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 4-(dihydroxyamino)oxybutyl 2-[[(Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoyl]amino]propanoate |
| SMILES | CC(NC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)C(=O)OCCCCON(O)O |
| InChI | InChI=1S/C29H43ClN2O10/c1-20(29(37)40-15-6-7-16-42-32(38)39)31-28(36)12-5-3-2-4-11-24-25(27(35)18-26(24)34)14-13-22(33)19-41-23-10-8-9-21(30)17-23/h2,4,8-10,13-14,17,20,22,24-27,33-35,38-39H,3,5-7,11-12,15-16,18-19H2,1H3,(H,31,36)/b4-2-,14-13+/t20?,22-,24-,25-,26+,27-/m1/s1 |
| InChIKey | RDLWJSVWJZKAMY-OPYPFATPSA-N |
| XLogP | 2.95 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.12 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|