C25H35ClN2O8 — CID 91311641
2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl nitrate (PubChem CID 91311641) has the molecular formula C25H35ClN2O8 and a molecular weight of 527.01 g/mol. Its IUPAC name is 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl nitrate.
| Compound Name | 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl nitrate |
|---|---|
| PubChem CID | 91311641 |
| Molecular Formula | C25H35ClN2O8 |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 2-[7-[(1R,2R,3R,5S)-2-[(3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoylamino]propyl nitrate |
| SMILES | CC(CO[N+](=O)[O-])NC(=O)CCCC=CC[C@@H]1[C@@H](C=C[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H35ClN2O8/c1-17(15-36-28(33)34)27-25(32)10-5-3-2-4-9-21-22(24(31)14-23(21)30)12-11-19(29)16-35-20-8-6-7-18(26)13-20/h2,4,6-8,11-13,17,19,21-24,29-31H,3,5,9-10,14-16H2,1H3,(H,27,32)/t17?,19-,21-,22-,23+,24-/m1/s1 |
| InChIKey | WUGNNMFQOLYDCS-HYGCEZRSSA-N |
| XLogP | 2.82 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|