C23H33ClO6 — CID 123827061
4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxy-7-methoxyhept-2-enyl)cyclopentane-1,3-diol (PubChem CID 123827061) has the molecular formula C23H33ClO6 and a molecular weight of 440.96 g/mol. Its IUPAC name is 4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxy-7-methoxyhept-2-enyl)cyclopentane-1,3-diol.
| Compound Name | 4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxy-7-methoxyhept-2-enyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 123827061 |
| Molecular Formula | C23H33ClO6 |
| Molecular Weight | 440.96 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxy-7-methoxyhept-2-enyl)cyclopentane-1,3-diol |
| SMILES | COC(O)CCCC=CCC1C(O)CC(O)C1C=CC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H33ClO6/c1-29-23(28)10-5-3-2-4-9-19-20(22(27)14-21(19)26)12-11-17(25)15-30-18-8-6-7-16(24)13-18/h2,4,6-8,11-13,17,19-23,25-28H,3,5,9-10,14-15H2,1H3 |
| InChIKey | ZHVFDNVKXJJVLX-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|