C30H38ClNO9 — CID 70669057
[3-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 70669057) has the molecular formula C30H38ClNO9 and a molecular weight of 592.09 g/mol. Its IUPAC name is [3-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669057 |
| Molecular Formula | C30H38ClNO9 |
| Molecular Weight | 592.09 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl (Z)-7-[(1R,2R,3R,5S)-2-[(E,3R)-4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@@H](O)COc2cccc(Cl)c2)[C@H](O)C[C@@H]1O)OCc1cccc(CON(O)O)c1 |
| InChI | InChI=1S/C30H38ClNO9/c31-23-9-6-10-25(16-23)39-20-24(33)13-14-27-26(28(34)17-29(27)35)11-3-1-2-4-12-30(36)40-18-21-7-5-8-22(15-21)19-41-32(37)38/h1,3,5-10,13-16,24,26-29,33-35,37-38H,2,4,11-12,17-20H2/b3-1-,14-13+/t24-,26-,27-,28+,29-/m1/s1 |
| InChIKey | KBBKZIIMKTTWLN-RXCBWOSTSA-N |
| XLogP | 4.37 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.09 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|