C22H31ClO5 — CID 91440427
trans-(4R,5R)-4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxyhept-2-enyl)cyclopentane-1,3-diol (PubChem CID 91440427) has the molecular formula C22H31ClO5 and a molecular weight of 410.94 g/mol. Its IUPAC name is trans-(4R,5R)-4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxyhept-2-enyl)cyclopentane-1,3-diol.
| Compound Name | trans-(4R,5R)-4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxyhept-2-enyl)cyclopentane-1,3-diol |
|---|---|
| PubChem CID | 91440427 |
| Molecular Formula | C22H31ClO5 |
| Molecular Weight | 410.94 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | trans-(4R,5R)-4-[4-(3-chlorophenoxy)-3-hydroxybut-1-enyl]-5-(7-hydroxyhept-2-enyl)cyclopentane-1,3-diol |
| SMILES | OCCCCC=CC[C@H]1C(O)CC(O)[C@@H]1C=CC(O)COc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H31ClO5/c23-16-7-6-8-18(13-16)28-15-17(25)10-11-20-19(21(26)14-22(20)27)9-4-2-1-3-5-12-24/h2,4,6-8,10-11,13,17,19-22,24-27H,1,3,5,9,12,14-15H2/t17?,19-,20-,21?,22?/m1/s1 |
| InChIKey | HUHQIQSVHHHCQY-VLZNWKPRSA-N |
| XLogP | 3.10 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.94 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|