C33H40F2O8 — CID 129289259
1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 129289259) has the molecular formula C33H40F2O8 and a molecular weight of 602.67 g/mol. Its IUPAC name is 1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | 1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 129289259 |
| Molecular Formula | C33H40F2O8 |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl (Z)-7-[(1R,2R,3R,5S)-2-[(E)-3,3-difluoro-4-phenoxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | C#CCC(CC#C)COC(=O)OC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/C(F)(F)COc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C33H40F2O8/c1-4-13-25(14-5-2)22-40-32(39)43-24(3)42-31(38)18-12-7-6-11-17-27-28(30(37)21-29(27)36)19-20-33(34,35)23-41-26-15-9-8-10-16-26/h1-2,6,8-11,15-16,19-20,24-25,27-30,36-37H,7,12-14,17-18,21-23H2,3H3/b11-6-,20-19+/t24?,27-,28-,29+,30-/m1/s1 |
| InChIKey | ZONBTLSVGYQQJH-KPBHBWINSA-N |
| XLogP | 5.44 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|