C26H34F4O5 — CID 91540078
propan-2-yl 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate (PubChem CID 91540078) has the molecular formula C26H34F4O5 and a molecular weight of 502.55 g/mol. Its IUPAC name is propan-2-yl 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91540078 |
| Molecular Formula | C26H34F4O5 |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | propan-2-yl 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCCC=CC[C@@H]1[C@@H](C=C[C@H](F)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H34F4O5/c1-17(2)35-25(33)11-6-4-3-5-10-21-22(24(32)15-23(21)31)13-12-19(27)16-34-20-9-7-8-18(14-20)26(28,29)30/h3,5,7-9,12-14,17,19,21-24,31-32H,4,6,10-11,15-16H2,1-2H3/t19-,21+,22+,23-,24+/m0/s1 |
| InChIKey | NGYKVDJLGVNXRF-HCSYDALLSA-N |
| XLogP | 5.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|