C34H48F3NO9 — CID 134463593
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-[(2-propoxyacetyl)amino]propanoyloxy]-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 134463593) has the molecular formula C34H48F3NO9 and a molecular weight of 671.75 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-[(2-propoxyacetyl)amino]propanoyloxy]-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-[(2-propoxyacetyl)amino]propanoyloxy]-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 134463593 |
| Molecular Formula | C34H48F3NO9 |
| Molecular Weight | 671.75 g/mol |
| Exact Mass | 671.33 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-[(2-propoxyacetyl)amino]propanoyloxy]-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCOCC(=O)NCCC(=O)O[C@H](/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OC(C)C)[C@@H](O)C[C@H]1O)COc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H48F3NO9/c1-4-18-44-22-31(41)38-17-16-33(43)47-26(21-45-25-11-9-10-24(19-25)34(35,36)37)14-15-28-27(29(39)20-30(28)40)12-7-5-6-8-13-32(42)46-23(2)3/h5,7,9-11,14-15,19,23,26-30,39-40H,4,6,8,12-13,16-18,20-22H2,1-3H3,(H,38,41)/b7-5-,15-14+/t26-,27-,28-,29+,30-/m1/s1 |
| InChIKey | SIQHUTOYBZLSLR-BNMFHGTCSA-N |
| XLogP | 4.91 |
| TPSA | 140.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|