C30H41F3O9 — CID 90107612
propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-hydroxy-2-(hydroxymethyl)propanoyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 90107612) has the molecular formula C30H41F3O9 and a molecular weight of 602.64 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-hydroxy-2-(hydroxymethyl)propanoyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-hydroxy-2-(hydroxymethyl)propanoyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90107612 |
| Molecular Formula | C30H41F3O9 |
| Molecular Weight | 602.64 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(E,3R)-3-[3-hydroxy-2-(hydroxymethyl)propanoyl]oxy-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](COc2cccc(C(F)(F)F)c2)OC(=O)C(CO)CO)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H41F3O9/c1-19(2)41-28(38)11-6-4-3-5-10-24-25(27(37)15-26(24)36)13-12-23(42-29(39)20(16-34)17-35)18-40-22-9-7-8-21(14-22)30(31,32)33/h3,5,7-9,12-14,19-20,23-27,34-37H,4,6,10-11,15-18H2,1-2H3/b5-3-,13-12+/t23-,24-,25-,26+,27-/m1/s1 |
| InChIKey | SDVZDFSNPDIRHG-NHILRPKVSA-N |
| XLogP | 3.58 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|