C23H28F4O5 — CID 91265219
7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid (PubChem CID 91265219) has the molecular formula C23H28F4O5 and a molecular weight of 460.46 g/mol. Its IUPAC name is 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 91265219 |
| Molecular Formula | C23H28F4O5 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 7-[(1R,2R,3R,5S)-2-[(3S)-3-fluoro-4-[3-(trifluoromethyl)phenoxy]but-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@@H](C=C[C@H](F)COc2cccc(C(F)(F)F)c2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C23H28F4O5/c24-16(14-32-17-7-5-6-15(12-17)23(25,26)27)10-11-19-18(20(28)13-21(19)29)8-3-1-2-4-9-22(30)31/h1,3,5-7,10-12,16,18-21,28-29H,2,4,8-9,13-14H2,(H,30,31)/t16-,18+,19+,20-,21+/m0/s1 |
| InChIKey | OZYIRLNMQAVYBJ-KTIPNOMGSA-N |
| XLogP | 4.54 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|