C33H43NO5 — CID 146484010
[1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 2-prop-2-ynylpent-4-ynoate (PubChem CID 146484010) has the molecular formula C33H43NO5 and a molecular weight of 533.71 g/mol. Its IUPAC name is [1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 2-prop-2-ynylpent-4-ynoate.
| Compound Name | [1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 2-prop-2-ynylpent-4-ynoate |
|---|---|
| PubChem CID | 146484010 |
| Molecular Formula | C33H43NO5 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | [1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 2-prop-2-ynylpent-4-ynoate |
| SMILES | C#CCC(CC#C)C(=O)OC(C=C[C@@H]1[C@@H](C/C=C\CCCC(=O)NCC)[C@@H](O)C[C@H]1O)CCc1ccccc1 |
| InChI | InChI=1S/C33H43NO5/c1-4-14-26(15-5-2)33(38)39-27(21-20-25-16-10-9-11-17-25)22-23-29-28(30(35)24-31(29)36)18-12-7-8-13-19-32(37)34-6-3/h1-2,7,9-12,16-17,22-23,26-31,35-36H,6,8,13-15,18-21,24H2,3H3,(H,34,37)/b12-7-,23-22?/t27?,28-,29-,30+,31-/m1/s1 |
| InChIKey | DXBDHNCXZBFYHW-QYJXBSGOSA-N |
| XLogP | 4.36 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|