C34H54N2O10 — CID 159207179
[(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate;nitroxyl (PubChem CID 159207179) has the molecular formula C34H54N2O10 and a molecular weight of 650.81 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate;nitroxyl.
| Compound Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate;nitroxyl |
|---|---|
| PubChem CID | 159207179 |
| Molecular Formula | C34H54N2O10 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 3-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]propanoate;nitroxyl |
| SMILES | CCNC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](CCc2ccccc2)OC(=O)CCOCCOCCOCCO)[C@H](O)C[C@@H]1O.N=O |
| InChI | InChI=1S/C34H53NO9.HNO/c1-2-35-33(39)13-9-4-3-8-12-29-30(32(38)26-31(29)37)17-16-28(15-14-27-10-6-5-7-11-27)44-34(40)18-20-41-22-24-43-25-23-42-21-19-36;1-2/h3,5-8,10-11,16-17,28-32,36-38H,2,4,9,12-15,18-26H2,1H3,(H,35,39);1H/b8-3-,17-16+;/t28-,29+,30+,31-,32+;/m0./s1 |
| InChIKey | KQAKDHVETGJRNU-PKFKODTASA-N |
| XLogP | 3.46 |
| TPSA | 184.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|