C32H49NO6 — CID 58231616
[(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 6-methoxyhexanoate (PubChem CID 58231616) has the molecular formula C32H49NO6 and a molecular weight of 543.75 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 6-methoxyhexanoate.
| Compound Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 6-methoxyhexanoate |
|---|---|
| PubChem CID | 58231616 |
| Molecular Formula | C32H49NO6 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] 6-methoxyhexanoate |
| SMILES | CCNC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](CCc2ccccc2)OC(=O)CCCCCOC)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C32H49NO6/c1-3-33-31(36)17-11-5-4-10-16-27-28(30(35)24-29(27)34)22-21-26(20-19-25-14-8-6-9-15-25)39-32(37)18-12-7-13-23-38-2/h4,6,8-10,14-15,21-22,26-30,34-35H,3,5,7,11-13,16-20,23-24H2,1-2H3,(H,33,36)/b10-4-,22-21+/t26-,27+,28+,29-,30+/m0/s1 |
| InChIKey | LFKXAPCOBSASHY-KBOBNPIJSA-N |
| XLogP | 4.90 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|