C25H37NO3 — CID 174048671
(Z)-7-[(1S,2S,3S,5R)-3,5-dihydroxy-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide (PubChem CID 174048671) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,5R)-3,5-dihydroxy-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide.
| Compound Name | (Z)-7-[(1S,2S,3S,5R)-3,5-dihydroxy-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
|---|---|
| PubChem CID | 174048671 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,5R)-3,5-dihydroxy-2-[(E)-5-phenylpent-1-enyl]cyclopentyl]-N-ethylhept-5-enamide |
| SMILES | CCNC(=O)CCC/C=C\C[C@H]1[C@H](/C=C/CCCc2ccccc2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C25H37NO3/c1-2-26-25(29)18-12-4-3-10-16-21-22(24(28)19-23(21)27)17-11-6-9-15-20-13-7-5-8-14-20/h3,5,7-8,10-11,13-14,17,21-24,27-28H,2,4,6,9,12,15-16,18-19H2,1H3,(H,26,29)/b10-3-,17-11+/t21-,22-,23+,24-/m0/s1 |
| InChIKey | AXXHVNODEVRXTR-IUILJMDVSA-N |
| XLogP | 4.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|