C30H42N2O8 — CID 163654300
[(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] (1S)-2-(nitrooxymethyl)cyclopropane-1-carboxylate (PubChem CID 163654300) has the molecular formula C30H42N2O8 and a molecular weight of 558.67 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] (1S)-2-(nitrooxymethyl)cyclopropane-1-carboxylate.
| Compound Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] (1S)-2-(nitrooxymethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 163654300 |
| Molecular Formula | C30H42N2O8 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.29 |
| IUPAC Name | [(E,3S)-1-[(1R,2R,3S,5R)-2-[(Z)-7-(ethylamino)-7-oxohept-2-enyl]-3,5-dihydroxycyclopentyl]-5-phenylpent-1-en-3-yl] (1S)-2-(nitrooxymethyl)cyclopropane-1-carboxylate |
| SMILES | CCNC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](CCc2ccccc2)OC(=O)[C@H]2CC2CO[N+](=O)[O-])[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H42N2O8/c1-2-31-29(35)13-9-4-3-8-12-24-25(28(34)19-27(24)33)17-16-23(15-14-21-10-6-5-7-11-21)40-30(36)26-18-22(26)20-39-32(37)38/h3,5-8,10-11,16-17,22-28,33-34H,2,4,9,12-15,18-20H2,1H3,(H,31,35)/b8-3-,17-16+/t22?,23-,24+,25+,26-,27-,28+/m0/s1 |
| InChIKey | IOVPVBHADCWJBS-PQCNASMQSA-N |
| XLogP | 3.54 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|