C34H49N3O14 — CID 58231626
[(E,3S)-1-[(1R,2R,3S,5R)-3-hydroxy-2-[(Z)-7-(methylamino)-7-oxohept-2-enyl]-5-(4-nitrooxybutoxycarbonyloxy)cyclopentyl]-5-phenylpent-1-en-3-yl] 4-nitrooxybutyl carbonate (PubChem CID 58231626) has the molecular formula C34H49N3O14 and a molecular weight of 723.77 g/mol. Its IUPAC name is [(E,3S)-1-[(1R,2R,3S,5R)-3-hydroxy-2-[(Z)-7-(methylamino)-7-oxohept-2-enyl]-5-(4-nitrooxybutoxycarbonyloxy)cyclopentyl]-5-phenylpent-1-en-3-yl] 4-nitrooxybutyl carbonate.
| Compound Name | [(E,3S)-1-[(1R,2R,3S,5R)-3-hydroxy-2-[(Z)-7-(methylamino)-7-oxohept-2-enyl]-5-(4-nitrooxybutoxycarbonyloxy)cyclopentyl]-5-phenylpent-1-en-3-yl] 4-nitrooxybutyl carbonate |
|---|---|
| PubChem CID | 58231626 |
| Molecular Formula | C34H49N3O14 |
| Molecular Weight | 723.77 g/mol |
| Exact Mass | 723.32 |
| IUPAC Name | [(E,3S)-1-[(1R,2R,3S,5R)-3-hydroxy-2-[(Z)-7-(methylamino)-7-oxohept-2-enyl]-5-(4-nitrooxybutoxycarbonyloxy)cyclopentyl]-5-phenylpent-1-en-3-yl] 4-nitrooxybutyl carbonate |
| SMILES | CNC(=O)CCC/C=C\C[C@@H]1[C@@H](/C=C/[C@H](CCc2ccccc2)OC(=O)OCCCCO[N+](=O)[O-])[C@H](OC(=O)OCCCCO[N+](=O)[O-])C[C@@H]1O |
| InChI | InChI=1S/C34H49N3O14/c1-35-32(39)16-8-3-2-7-15-28-29(31(25-30(28)38)51-34(41)47-22-10-12-24-49-37(44)45)20-19-27(18-17-26-13-5-4-6-14-26)50-33(40)46-21-9-11-23-48-36(42)43/h2,4-7,13-14,19-20,27-31,38H,3,8-12,15-18,21-25H2,1H3,(H,35,39)/b7-2-,20-19+/t27-,28+,29+,30-,31+/m0/s1 |
| InChIKey | AUUDFXXYZXUGQT-NWPPVBJRSA-N |
| XLogP | 5.06 |
| TPSA | 225.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.77 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|