C29H45NO8 — CID 11353146
6-nitrooxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 11353146) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is 6-nitrooxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | 6-nitrooxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11353146 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | 6-nitrooxyhexyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)OCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C29H45NO8/c31-24(17-16-23-12-6-5-7-13-23)18-19-26-25(27(32)22-28(26)33)14-8-1-2-9-15-29(34)37-20-10-3-4-11-21-38-30(35)36/h1,5-8,12-13,24-28,31-33H,2-4,9-11,14-22H2/b8-1-/t24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | LWIIHSWUUNBLED-KOHFJXKSSA-N |
| XLogP | 4.55 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|