C31H51NO7 — CID 24856666
acetic acid;2-(diethylamino)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 24856666) has the molecular formula C31H51NO7 and a molecular weight of 549.75 g/mol. Its IUPAC name is acetic acid;2-(diethylamino)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | acetic acid;2-(diethylamino)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 24856666 |
| Molecular Formula | C31H51NO7 |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.37 |
| IUPAC Name | acetic acid;2-(diethylamino)ethyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | CC(=O)O.CCN(CC)CCOC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C29H47NO5.C2H4O2/c1-3-30(4-2)20-21-35-29(34)15-11-6-5-10-14-25-26(28(33)22-27(25)32)19-18-24(31)17-16-23-12-8-7-9-13-23;1-2(3)4/h5,7-10,12-13,24-28,31-33H,3-4,6,11,14-22H2,1-2H3;1H3,(H,3,4)/b10-5-;/t24-,25+,26+,27-,28+;/m0./s1 |
| InChIKey | YZOMRKHVIQEKNT-QDYYLUAOSA-N |
| XLogP | 4.21 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|