C35H46O9 — CID 86685661
3-[2-(3-formylphenoxy)acetyl]oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 86685661) has the molecular formula C35H46O9 and a molecular weight of 610.74 g/mol. Its IUPAC name is 3-[2-(3-formylphenoxy)acetyl]oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | 3-[2-(3-formylphenoxy)acetyl]oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 86685661 |
| Molecular Formula | C35H46O9 |
| Molecular Weight | 610.74 g/mol |
| Exact Mass | 610.31 |
| IUPAC Name | 3-[2-(3-formylphenoxy)acetyl]oxypropyl (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | O=Cc1cccc(OCC(=O)OCCCOC(=O)CCC/C=C\C[C@@H]2[C@@H](CC[C@@H](O)CCc3ccccc3)[C@H](O)C[C@@H]2O)c1 |
| InChI | InChI=1S/C35H46O9/c36-24-27-12-8-13-29(22-27)44-25-35(41)43-21-9-20-42-34(40)15-7-2-1-6-14-30-31(33(39)23-32(30)38)19-18-28(37)17-16-26-10-4-3-5-11-26/h1,3-6,8,10-13,22,24,28,30-33,37-39H,2,7,9,14-21,23,25H2/b6-1-/t28-,30+,31+,32-,33+/m0/s1 |
| InChIKey | UMOMLPVDZBVJRI-WCMRVWTISA-N |
| XLogP | 4.60 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|