C30H41NO8 — CID 70669103
[3-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate (PubChem CID 70669103) has the molecular formula C30H41NO8 and a molecular weight of 543.66 g/mol. Its IUPAC name is [3-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate.
| Compound Name | [3-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669103 |
| Molecular Formula | C30H41NO8 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | [3-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoate |
| SMILES | O=C(CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)Oc1cccc(CON(O)O)c1 |
| InChI | InChI=1S/C30H41NO8/c32-24(16-15-22-9-4-3-5-10-22)17-18-27-26(28(33)20-29(27)34)13-6-1-2-7-14-30(35)39-25-12-8-11-23(19-25)21-38-31(36)37/h1,3-6,8-12,19,24,26-29,32-34,36-37H,2,7,13-18,20-21H2/b6-1-/t24-,26+,27+,28-,29+/m0/s1 |
| InChIKey | OQRLBMCUCDARQW-WEWVERJPSA-N |
| XLogP | 4.35 |
| TPSA | 139.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|