C34H48N2O9 — CID 89069059
[3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate (PubChem CID 89069059) has the molecular formula C34H48N2O9 and a molecular weight of 628.76 g/mol. Its IUPAC name is [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate.
| Compound Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 89069059 |
| Molecular Formula | C34H48N2O9 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-[(3R)-3-hydroxy-5-phenylpentyl]cyclopentyl]hept-5-enoyl]amino]propanoate |
| SMILES | CC(NC(=O)CCC/C=C\C[C@@H]1[C@@H](CC[C@@H](O)CCc2ccccc2)[C@H](O)C[C@@H]1O)C(=O)OCc1cccc(CON(O)O)c1 |
| InChI | InChI=1S/C34H48N2O9/c1-24(34(41)44-22-26-12-9-13-27(20-26)23-45-36(42)43)35-33(40)15-8-3-2-7-14-29-30(32(39)21-31(29)38)19-18-28(37)17-16-25-10-5-4-6-11-25/h2,4-7,9-13,20,24,28-32,37-39,42-43H,3,8,14-19,21-23H2,1H3,(H,35,40)/b7-2-/t24?,28-,29+,30+,31-,32+/m0/s1 |
| InChIKey | LANJFEKBDPWUTP-PNUYYMPHSA-N |
| XLogP | 3.99 |
| TPSA | 169.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|