C33H52N2O9 — CID 89068951
[3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate (PubChem CID 89068951) has the molecular formula C33H52N2O9 and a molecular weight of 620.78 g/mol. Its IUPAC name is [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate.
| Compound Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 89068951 |
| Molecular Formula | C33H52N2O9 |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.37 |
| IUPAC Name | [3-[(dihydroxyamino)oxymethyl]phenyl]methyl 2-[[(Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoyl]amino]propanoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)NC(C)C(=O)OCc2cccc(CON(O)O)c2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C33H52N2O9/c1-3-4-5-6-9-15-27(36)18-19-29-28(30(37)21-31(29)38)16-10-7-8-11-17-32(39)34-24(2)33(40)43-22-25-13-12-14-26(20-25)23-44-35(41)42/h7,10,12-14,20,24,28-31,37-38,41-42H,3-6,8-9,11,15-19,21-23H2,1-2H3,(H,34,39)/b10-7-/t24?,28-,29-,30+,31-/m1/s1 |
| InChIKey | WYAHOXKXSUPSJK-FINXEZPLSA-N |
| XLogP | 4.93 |
| TPSA | 165.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|