C30H46N2O7 — CID 90937559
[2-[[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]methyl]phenyl]methyl nitrate (PubChem CID 90937559) has the molecular formula C30H46N2O7 and a molecular weight of 546.71 g/mol. Its IUPAC name is [2-[[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]methyl]phenyl]methyl nitrate.
| Compound Name | [2-[[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]methyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 90937559 |
| Molecular Formula | C30H46N2O7 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | [2-[[7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoylamino]methyl]phenyl]methyl nitrate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)NCc2ccccc2CO[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C30H46N2O7/c1-2-3-4-5-8-15-25(33)18-19-27-26(28(34)20-29(27)35)16-9-6-7-10-17-30(36)31-21-23-13-11-12-14-24(23)22-39-32(37)38/h6,9,11-14,26-29,34-35H,2-5,7-8,10,15-22H2,1H3,(H,31,36)/t26-,27-,28+,29-/m1/s1 |
| InChIKey | PSERJUKKJGLHQQ-OVHUPFAXSA-N |
| XLogP | 5.20 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|