C29H43NO8 — CID 90913198
[2-(nitrooxymethyl)phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 90913198) has the molecular formula C29H43NO8 and a molecular weight of 533.66 g/mol. Its IUPAC name is [2-(nitrooxymethyl)phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | [2-(nitrooxymethyl)phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 90913198 |
| Molecular Formula | C29H43NO8 |
| Molecular Weight | 533.66 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | [2-(nitrooxymethyl)phenyl] 7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](CC=CCCCC(=O)Oc2ccccc2CO[N+](=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C29H43NO8/c1-2-3-4-5-8-14-23(31)18-19-25-24(26(32)20-27(25)33)15-9-6-7-10-17-29(34)38-28-16-12-11-13-22(28)21-37-30(35)36/h6,9,11-13,16,24-27,32-33H,2-5,7-8,10,14-15,17-21H2,1H3/t24-,25-,26+,27-/m1/s1 |
| InChIKey | ZJIBXHWDNVCNLE-JVYGEBFASA-N |
| XLogP | 5.48 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|