C29H45NO8 — CID 70669084
[4-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate (PubChem CID 70669084) has the molecular formula C29H45NO8 and a molecular weight of 535.68 g/mol. Its IUPAC name is [4-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate.
| Compound Name | [4-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 70669084 |
| Molecular Formula | C29H45NO8 |
| Molecular Weight | 535.68 g/mol |
| Exact Mass | 535.31 |
| IUPAC Name | [4-[(dihydroxyamino)oxymethyl]phenyl] (Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)Oc2ccc(CON(O)O)cc2)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C29H45NO8/c1-2-3-4-5-8-11-23(31)16-19-26-25(27(32)20-28(26)33)12-9-6-7-10-13-29(34)38-24-17-14-22(15-18-24)21-37-30(35)36/h6,9,14-15,17-18,25-28,32-33,35-36H,2-5,7-8,10-13,16,19-21H2,1H3/b9-6-/t25-,26-,27+,28-/m1/s1 |
| InChIKey | QPXFYQIKWAXGDB-JYOWYFRYSA-N |
| XLogP | 5.29 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|