C29H52O5 — CID 91303406
propan-2-yl 11-[(2R)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]undec-9-enoate (PubChem CID 91303406) has the molecular formula C29H52O5 and a molecular weight of 480.73 g/mol. Its IUPAC name is propan-2-yl 11-[(2R)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]undec-9-enoate.
| Compound Name | propan-2-yl 11-[(2R)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]undec-9-enoate |
|---|---|
| PubChem CID | 91303406 |
| Molecular Formula | C29H52O5 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | propan-2-yl 11-[(2R)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]undec-9-enoate |
| SMILES | CCCCCCCC(=O)CC[C@H]1C(O)CC(O)C1CC=CCCCCCCCC(=O)OC(C)C |
| InChI | InChI=1S/C29H52O5/c1-4-5-6-11-14-17-24(30)20-21-26-25(27(31)22-28(26)32)18-15-12-9-7-8-10-13-16-19-29(33)34-23(2)3/h12,15,23,25-28,31-32H,4-11,13-14,16-22H2,1-3H3/t25?,26-,27?,28?/m1/s1 |
| InChIKey | KQIUPQZUKQOKAI-MNKIWLFQSA-N |
| XLogP | 6.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|